EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H25ClN2OS |
| Net Charge | 0 |
| Average Mass | 364.942 |
| Monoisotopic Mass | 364.13761 |
| SMILES | CC(C)(C)c1ccc(CSc2cnn(C(C)(C)C)c(=O)c2Cl)cc1 |
| InChI | InChI=1S/C19H25ClN2OS/c1-18(2,3)14-9-7-13(8-10-14)12-24-15-11-21-22(19(4,5)6)17(23)16(15)20/h7-11H,12H2,1-6H3 |
| InChIKey | DWFZBUWUXWZWKD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | |
| Applications: | insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. acaricide A substance used to destroy pests of the subclass Acari (mites and ticks). pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pyridaben (CHEBI:38626) has role mitochondrial NADH:ubiquinone reductase inhibitor (CHEBI:38498) |
| pyridaben (CHEBI:38626) is a organochlorine acaricide (CHEBI:38657) |
| pyridaben (CHEBI:38626) is a organochlorine insecticide (CHEBI:25705) |
| pyridaben (CHEBI:38626) is a pyridazinone (CHEBI:26414) |
| IUPAC Name |
|---|
| 2-tert-butyl-5-[(4-tert-butylbenzyl)thio]-4-chloropyridazin-3(2H)-one |
| Synonyms | Source |
|---|---|
| 4-chloro-2-(1,1-dimethylethyl)-5-(((4-(1,1-dimethylethyl)phenyl)methyl)thio)-3(2H)-pyridazinone | ChemIDplus |
| pyridaben | ChemIDplus |
| Sanmite | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:7933972 | Beilstein |
| CAS:96489-71-3 | ChemIDplus |
| CAS:96489-71-3 | KEGG COMPOUND |