EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:38604 - pyrimidifen
| Formula | C20H28ClN3O2 |
| Net Charge | 0 |
| Average Mass | 377.916 |
| Monoisotopic Mass | 377.18700 |
| SMILES | CCOCCc1ccc(OCCNc2ncnc(CC)c2Cl)c(C)c1C |
| InChI | InChI=1S/C20H28ClN3O2/c1-5-17-19(21)20(24-13-23-17)22-10-12-26-18-8-7-16(9-11-25-6-2)14(3)15(18)4/h7-8,13H,5-6,9-12H2,1-4H3,(H,22,23,24) |
| InChIKey | ITKAIUGKVKDENI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | |
| Applications: | insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. acaricide A substance used to destroy pests of the subclass Acari (mites and ticks). pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pyrimidifen (CHEBI:38604) has role mitochondrial NADH:ubiquinone reductase inhibitor (CHEBI:38498) |
| pyrimidifen (CHEBI:38604) is a aminopyrimidine (CHEBI:38338) |
| pyrimidifen (CHEBI:38604) is a pyrimidinamine acaricide (CHEBI:38612) |
| pyrimidifen (CHEBI:38604) is a pyrimidinamine insecticide (CHEBI:38611) |
| IUPAC Name |
|---|
| 5-chloro-N-{2-[4-(2-ethoxyethyl)-2,3-dimethylphenoxy]ethyl}-6-ethylpyrimidin-4-amine |
| Synonyms | Source |
|---|---|
| pyrimidifen | ChemIDplus |
| 5-chloro-N-(2-(4-(2-ethoxyethyl)-2,3-dimethylphenoxy)ethyl)-6-ethyl-4-pyrimidinamine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C18603 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:105779-78-0 | ChemIDplus |
| CAS:105779-78-0 | KEGG COMPOUND |