EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H22N2O |
| Net Charge | 0 |
| Average Mass | 306.409 |
| Monoisotopic Mass | 306.17321 |
| SMILES | CC(C)(C)c1ccc(CCOc2ncnc3ccccc23)cc1 |
| InChI | InChI=1S/C20H22N2O/c1-20(2,3)16-10-8-15(9-11-16)12-13-23-19-17-6-4-5-7-18(17)21-14-22-19/h4-11,14H,12-13H2,1-3H3 |
| InChIKey | DMYHGDXADUDKCQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | |
| Application: | acaricide A substance used to destroy pests of the subclass Acari (mites and ticks). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fenazaquin (CHEBI:38593) has role acaricide (CHEBI:22153) |
| fenazaquin (CHEBI:38593) has role mitochondrial NADH:ubiquinone reductase inhibitor (CHEBI:38498) |
| fenazaquin (CHEBI:38593) is a quinazolines (CHEBI:38530) |
| IUPAC Name |
|---|
| 4-[2-(4-tert-butylphenyl)ethoxy]quinazoline |
| Synonyms | Source |
|---|---|
| 4-tert-butylphenethylquinazolin-4-yl ether | ChemIDplus |
| fenazaquin | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:8331263 | Beilstein |
| CAS:120928-09-8 | ChemIDplus |
| CAS:120928-09-8 | KEGG COMPOUND |