EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:38591 - fluacrypyrim
| Formula | C20H21F3N2O5 |
| Net Charge | 0 |
| Average Mass | 426.391 |
| Monoisotopic Mass | 426.14026 |
| SMILES | CO/C=C(/C(=O)OC)c1ccccc1COc1cc(C(F)(F)F)nc(OC(C)C)n1 |
| InChI | InChI=1S/C20H21F3N2O5/c1-12(2)30-19-24-16(20(21,22)23)9-17(25-19)29-10-13-7-5-6-8-14(13)15(11-27-3)18(26)28-4/h5-9,11-12H,10H2,1-4H3/b15-11+ |
| InChIKey | MXWAGQASUDSFBG-RVDMUPIBSA-N |
| Roles Classification |
|---|
| Biological Role: | |
| Applications: | acaricide A substance used to destroy pests of the subclass Acari (mites and ticks). pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fluacrypyrim (CHEBI:38591) has role mitochondrial cytochrome-bc1 complex inhibitor (CHEBI:38499) |
| fluacrypyrim (CHEBI:38591) is a enoate ester (CHEBI:51702) |
| fluacrypyrim (CHEBI:38591) is a enol ether (CHEBI:47985) |
| fluacrypyrim (CHEBI:38591) is a methyl ester (CHEBI:25248) |
| fluacrypyrim (CHEBI:38591) is a organofluorine acaricide (CHEBI:38806) |
| fluacrypyrim (CHEBI:38591) is a pyrimidines (CHEBI:39447) |
| IUPAC Name |
|---|
| methyl (2E)-2-[2-({[2-(propan-2-yl)oxy-6-(trifluoromethyl)pyrimidin-4-yl]oxy}methyl)phenyl]-3-methoxyacrylate |
| Synonyms | Source |
|---|---|
| fluacrypyrim | ChemIDplus |
| methyl (2E)-2-[2-({[2-isopropoxy-6-(trifluoromethyl)pyrimidin-4-yl]oxy}methyl)phenyl]-3-methoxyacrylate | IUPAC |
| Registry Numbers | Sources |
|---|---|
| CAS:229977-93-9 | ChemIDplus |
| CAS:229977-93-9 | KEGG COMPOUND |