EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H11Cl4O3PS |
| Net Charge | 0 |
| Average Mass | 336.004 |
| Monoisotopic Mass | 333.89206 |
| SMILES | CCOP(=S)(OCC)OC(Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C6H11Cl4O3PS/c1-3-11-14(15,12-4-2)13-5(7)6(8,9)10/h5H,3-4H2,1-2H3 |
| InChIKey | XFDJMIHUAHSGKG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 3.1.1.7 (acetylcholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of enzyme acetylcholinesterase (EC 3.1.1.7), which helps breaking down of acetylcholine into choline and acetic acid. |
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chlorethoxyfos (CHEBI:38590) has role agrochemical (CHEBI:33286) |
| chlorethoxyfos (CHEBI:38590) has role EC 3.1.1.7 (acetylcholinesterase) inhibitor (CHEBI:38462) |
| chlorethoxyfos (CHEBI:38590) is a organic thiophosphate (CHEBI:37512) |
| chlorethoxyfos (CHEBI:38590) is a organochlorine insecticide (CHEBI:25705) |
| chlorethoxyfos (CHEBI:38590) is a organothiophosphate insecticide (CHEBI:25715) |
| IUPAC Name |
|---|
| O,O-diethyl O-(1,2,2,2-tetrachloroethyl) phosphorothioate |
| Synonyms | Source |
|---|---|
| Chlorethoxyphos | ChemIDplus |
| Chloroethoxyfos | ChemIDplus |
| O,O-diethyl O-(1,2,2,2-tetrachloroethyl) thiophosphate | IUPAC |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2505303 | Beilstein |
| CAS:54593-83-8 | ChemIDplus |
| CAS:54593-83-8 | KEGG COMPOUND |