EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:38587 - azinphos-ethyl
| Formula | C12H16N3O3PS2 |
| Net Charge | 0 |
| Average Mass | 345.386 |
| Monoisotopic Mass | 345.03707 |
| SMILES | CCOP(=S)(OCC)SCn1nnc2ccccc2c1=O |
| InChI | InChI=1S/C12H16N3O3PS2/c1-3-17-19(20,18-4-2)21-9-15-12(16)10-7-5-6-8-11(10)13-14-15/h5-8H,3-4,9H2,1-2H3 |
| InChIKey | RQVGAIADHNPSME-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 3.1.1.7 (acetylcholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of enzyme acetylcholinesterase (EC 3.1.1.7), which helps breaking down of acetylcholine into choline and acetic acid. |
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. acaricide A substance used to destroy pests of the subclass Acari (mites and ticks). insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| azinphos-ethyl (CHEBI:38587) has parent hydride 1,2,3-benzotriazine (CHEBI:38586) |
| azinphos-ethyl (CHEBI:38587) has role acaricide (CHEBI:22153) |
| azinphos-ethyl (CHEBI:38587) has role agrochemical (CHEBI:33286) |
| azinphos-ethyl (CHEBI:38587) has role EC 3.1.1.7 (acetylcholinesterase) inhibitor (CHEBI:38462) |
| azinphos-ethyl (CHEBI:38587) is a organic thiophosphate (CHEBI:37512) |
| azinphos-ethyl (CHEBI:38587) is a organothiophosphate insecticide (CHEBI:25715) |
| IUPAC Name |
|---|
| O,O-diethyl S-[(4-oxo-1,2,3-benzotriazin-3(4H)-yl)methyl] phosphorodithioate |
| Synonyms | Source |
|---|---|
| Azinphos ethyl | ChemIDplus |
| Gusathion | ChemIDplus |
| Ethyl azinphos | ChemIDplus |
| 3,4-Dihydro-4-oxo-3-benzotriazinylmethyl O,O-diethyl phosphorodithioate | ChemIDplus |
| O,O-Diethyl S-((4-oxo-1,2,3-benzotriazin-3(4H)-yl)methyl) phosphorodithioate | ChemIDplus |
| Phosphorodithioic acid, O,O-diethyl S-((4-oxo-1,2,3-benzotriazin-3(4H)-yl)methyl) ester | ChemIDplus |