EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H22N4O3S |
| Net Charge | 0 |
| Average Mass | 314.411 |
| Monoisotopic Mass | 314.14126 |
| SMILES | CCOC(=O)CSc1nc(C(C)(C)C)nn1C(=O)N(C)C |
| InChI | InChI=1S/C13H22N4O3S/c1-7-20-9(18)8-21-11-14-10(13(2,3)4)15-17(11)12(19)16(5)6/h7-8H2,1-6H3 |
| InChIKey | NKNFWVNSBIXGLL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 3.1.1.7 (acetylcholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of enzyme acetylcholinesterase (EC 3.1.1.7), which helps breaking down of acetylcholine into choline and acetic acid. |
| Application: | insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| triazamate (CHEBI:38576) has parent hydride 1H-1,2,4-triazole (CHEBI:35550) |
| triazamate (CHEBI:38576) has role EC 3.1.1.7 (acetylcholinesterase) inhibitor (CHEBI:38462) |
| triazamate (CHEBI:38576) is a aryl sulfide (CHEBI:35683) |
| triazamate (CHEBI:38576) is a ethyl ester (CHEBI:23990) |
| triazamate (CHEBI:38576) is a triazole insecticide (CHEBI:38577) |
| IUPAC Name |
|---|
| ethyl {[3-tert-butyl-1-(dimethylcarbamoyl)-1H-1,2,4-triazol-5-yl]sulfanyl}acetate |
| Synonym | Source |
|---|---|
| Triazuron | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:112143-82-5 | ChemIDplus |
| CAS:112143-82-5 | KEGG COMPOUND |