EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H20N4O2 |
| Net Charge | 0 |
| Average Mass | 384.439 |
| Monoisotopic Mass | 384.15863 |
| SMILES | N#Cc1ccc(N/C(=N\CC(=O)O)NC(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H20N4O2/c24-15-17-11-13-20(14-12-17)26-23(25-16-21(28)29)27-22(18-7-3-1-4-8-18)19-9-5-2-6-10-19/h1-14,22H,16H2,(H,28,29)(H2,25,26,27) |
| InChIKey | KGHMYJFHUHFOGL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | sweetening agent Substance that sweeten food, beverages, medications, etc. |
| Biological Roles: | epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. sweetening agent Substance that sweeten food, beverages, medications, etc. |
| Application: | sweetening agent Substance that sweeten food, beverages, medications, etc. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| [N-(4-cyanophenyl)-N'-(diphenylmethyl)guanidine]acetic acid (CHEBI:385425) has role epitope (CHEBI:53000) |
| [N-(4-cyanophenyl)-N'-(diphenylmethyl)guanidine]acetic acid (CHEBI:385425) has role sweetening agent (CHEBI:50505) |
| [N-(4-cyanophenyl)-N'-(diphenylmethyl)guanidine]acetic acid (CHEBI:385425) is a glycine derivative (CHEBI:24373) |
| [N-(4-cyanophenyl)-N'-(diphenylmethyl)guanidine]acetic acid (CHEBI:385425) is a guanidines (CHEBI:24436) |
| IUPAC Name |
|---|
| (Z)-N-{[(4-cyanophenyl)amino][(diphenylmethyl)amino]methylidene}glycine |
| Synonyms | Source |
|---|---|
| 2-[[(benzhydrylamino)-[(4-cyanophenyl)amino]methylidene]amino]ethanoic acid | PDB |
| CP-Dpm-GA | ChemIDplus |
| N-(4-Cyanophenyl)-N'-(diphenylmethyl)guanidineacetic acid | ChemIDplus |
| NC-174 | ChemIDplus |
| N-(P-CYANOPHENYL)-N'-DIPHENYLMETHYL-GUANIDINE-ACETIC ACID | PDBeChem |
| N-(p-Cyanophenyl)-N'-(diphenylmethyl)-N''-(carboxymethyl)guanidine | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:25965952 | Reaxys |
| CAS:138460-25-0 | ChemIDplus |
| Citations |
|---|