EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H15NO2S |
| Net Charge | 0 |
| Average Mass | 225.313 |
| Monoisotopic Mass | 225.08235 |
| SMILES | CNC(=O)Oc1cc(C)c(SC)c(C)c1 |
| InChI | InChI=1S/C11H15NO2S/c1-7-5-9(14-11(13)12-3)6-8(2)10(7)15-4/h5-6H,1-4H3,(H,12,13) |
| InChIKey | YFBPRJGDJKVWAH-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Roles: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. EC 3.1.1.7 (acetylcholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of enzyme acetylcholinesterase (EC 3.1.1.7), which helps breaking down of acetylcholine into choline and acetic acid. |
| Applications: | acaricide A substance used to destroy pests of the subclass Acari (mites and ticks). agrochemical An agrochemical is a substance that is used in agriculture or horticulture. molluscicide A substance used to destroy pests of the phylum Mollusca. insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. avicide A substance used to destroy bird pests (class Aves). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methiocarb (CHEBI:38508) has functional parent 3,5-dimethyl-4-(methylsulfanyl)phenol (CHEBI:38509) |
| methiocarb (CHEBI:38508) has functional parent methylcarbamic acid (CHEBI:45379) |
| methiocarb (CHEBI:38508) has role acaricide (CHEBI:22153) |
| methiocarb (CHEBI:38508) has role agrochemical (CHEBI:33286) |
| methiocarb (CHEBI:38508) has role avicide (CHEBI:33289) |
| methiocarb (CHEBI:38508) has role EC 3.1.1.7 (acetylcholinesterase) inhibitor (CHEBI:38462) |
| methiocarb (CHEBI:38508) has role environmental contaminant (CHEBI:78298) |
| methiocarb (CHEBI:38508) has role insecticide (CHEBI:24852) |
| methiocarb (CHEBI:38508) has role molluscicide (CHEBI:33904) |
| methiocarb (CHEBI:38508) has role xenobiotic (CHEBI:35703) |
| methiocarb (CHEBI:38508) is a aryl sulfide (CHEBI:35683) |
| methiocarb (CHEBI:38508) is a carbamate ester (CHEBI:23003) |
| methiocarb (CHEBI:38508) is a methyl sulfide (CHEBI:86315) |
| IUPAC Name |
|---|
| 3,5-dimethyl-4-(methylsulfanyl)phenyl methylcarbamate |
| Synonyms | Source |
|---|---|
| 3,5-Dimethyl-4-(methylthio)phenol methylcarbamate | ChemIDplus |
| 3,5-Dimethyl-4-(methylthio)phenyl methylcarbamate | ChemIDplus |
| 3,5-Dimethyl-4-methylthiophenyl N-methylcarbamate | ChemIDplus |
| 4-Methylmercapto-3,5-dimethylphenyl N-methylcarbamate | ChemIDplus |
| 4-Methylmercapto-3,5-xylyl methylcarbamate | ChemIDplus |
| 4-Methylthio-3,5-dimethylphenyl methylcarbamate | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 457 | PPDB |
| C18651 | KEGG COMPOUND |
| methiocarb | Alan Wood's Pesticides |
| Methiocarb | Wikipedia |
| Citations |
|---|