EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H28N2O2 |
| Net Charge | 0 |
| Average Mass | 352.478 |
| Monoisotopic Mass | 352.21508 |
| SMILES | CCc1ccc(C(=O)NN(C(=O)c2cc(C)cc(C)c2)C(C)(C)C)cc1 |
| InChI | InChI=1S/C22H28N2O2/c1-7-17-8-10-18(11-9-17)20(25)23-24(22(4,5)6)21(26)19-13-15(2)12-16(3)14-19/h8-14H,7H2,1-6H3,(H,23,25) |
| InChIKey | QYPNKSZPJQQLRK-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Roles: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Application: |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tebufenozide (CHEBI:38452) has functional parent N'-benzoyl-N-(tert-butyl)benzohydrazide (CHEBI:38457) |
| tebufenozide (CHEBI:38452) has role ecdysone agonist (CHEBI:38456) |
| tebufenozide (CHEBI:38452) has role environmental contaminant (CHEBI:78298) |
| tebufenozide (CHEBI:38452) has role xenobiotic (CHEBI:35703) |
| tebufenozide (CHEBI:38452) is a carbohydrazide (CHEBI:35363) |
| IUPAC Name |
|---|
| N-tert-butyl-N'-(4-ethylbenzoyl)-3,5-dimethylbenzohydrazide |
| Synonyms | Source |
|---|---|
| 3,5-dimethylbenzoic acid 1-(1,1-dimethylethyl)-2-(4-ethylbenzoyl)hydrazide | ChemIDplus |
| N'-(t-butyl)-N'-(3,5-dimethylbenzoyl)-N-(4-ethylbenzoyl)hydrazine | ChemIDplus |
| tebufenozide | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 611 | PPDB |
| C18526 | KEGG COMPOUND |
| CN103553255 | Patent |
| CN103766364 | Patent |
| tebufenozide | Alan Wood's Pesticides |
| Tebufenozide | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7822297 | Reaxys |
| CAS:112410-23-8 | ChemIDplus |
| CAS:112410-23-8 | KEGG COMPOUND |
| Citations |
|---|