EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H28N2O3 |
| Net Charge | 0 |
| Average Mass | 368.477 |
| Monoisotopic Mass | 368.20999 |
| SMILES | COc1cccc(C(=O)NN(C(=O)c2cc(C)cc(C)c2)C(C)(C)C)c1C |
| InChI | InChI=1S/C22H28N2O3/c1-14-11-15(2)13-17(12-14)21(26)24(22(4,5)6)23-20(25)18-9-8-10-19(27-7)16(18)3/h8-13H,1-7H3,(H,23,25) |
| InChIKey | QCAWEPFNJXQPAN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Application: | insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methoxyfenozide (CHEBI:38449) has functional parent N'-benzoyl-N-(tert-butyl)benzohydrazide (CHEBI:38457) |
| methoxyfenozide (CHEBI:38449) has role environmental contaminant (CHEBI:78298) |
| methoxyfenozide (CHEBI:38449) has role insecticide (CHEBI:24852) |
| methoxyfenozide (CHEBI:38449) has role xenobiotic (CHEBI:35703) |
| methoxyfenozide (CHEBI:38449) is a carbohydrazide (CHEBI:35363) |
| methoxyfenozide (CHEBI:38449) is a monomethoxybenzene (CHEBI:25235) |
| IUPAC Name |
|---|
| N'-tert-butyl-N'-(3,5-dimethylbenzoyl)-3-methoxy-2-methylbenzohydrazide |
| Synonyms | Source |
|---|---|
| 3-methoxy-2-methylbenzoic acid 2-(3,5-dimethylbenzoyl)-2-(1,1-dimethylethyl)hydrazide | ChemIDplus |
| N'-(tert-butyl)-N'-(3,5-dimethylbenzoyl)-3-methoxy-2-methylbenzohydrazide | ChemIDplus |
| N-tert-butyl-N'-(3-methoxy-o-toluoyl)-3,5-xylohydrazide | ChemIDplus |
| methoxyfenozide | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 461 | PPDB |
| C18525 | KEGG COMPOUND |
| methoxyfenozide | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8435860 | Reaxys |
| CAS:161050-58-4 | ChemIDplus |
| CAS:161050-58-4 | KEGG COMPOUND |