EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H5ClO4 |
| Net Charge | 0 |
| Average Mass | 176.555 |
| Monoisotopic Mass | 175.98764 |
| SMILES | O=C(O)/C=C(Cl)/C=C/C(=O)O |
| InChI | InChI=1S/C6H5ClO4/c7-4(3-6(10)11)1-2-5(8)9/h1-3H,(H,8,9)(H,10,11)/b2-1+,4-3- |
| InChIKey | ICMVYBXQDUXEEE-XLFBNKDWSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-chloro-trans,trans-muconic acid (CHEBI:38433) has functional parent trans,trans-muconic acid (CHEBI:27036) |
| 3-chloro-trans,trans-muconic acid (CHEBI:38433) is a 3-chloromuconic acid (CHEBI:38428) |
| IUPAC Name |
|---|
| (2Z,4E)-3-chlorohexa-2,4-dienedioic acid |