EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H4Cl2O4 |
| Net Charge | 0 |
| Average Mass | 211.000 |
| Monoisotopic Mass | 209.94866 |
| SMILES | [H]C(C([H])=C(Cl)C(=O)O)=C(Cl)C(=O)O |
| InChI | InChI=1S/C6H4Cl2O4/c7-3(5(9)10)1-2-4(8)6(11)12/h1-2H,(H,9,10)(H,11,12) |
| InChIKey | HECLTTZJJYETPR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,5-dichloromuconic acid (CHEBI:38421) is a dichloromuconic acid (CHEBI:38422) |
| Incoming Relation(s) |
| 2,5-dichloro-cis,cis-muconic acid (CHEBI:28558) is a 2,5-dichloromuconic acid (CHEBI:38421) |
| 2,5-dichloro-trans,trans-muconic acid (CHEBI:38423) is a 2,5-dichloromuconic acid (CHEBI:38421) |
| IUPAC Name |
|---|
| 2,5-dichlorohexa-2,4-dienedioic acid |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1725836 | Beilstein |