EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:38397 - perfluorononanoic acid
| Formula | C9HF17O2 |
| Net Charge | 0 |
| Average Mass | 464.071 |
| Monoisotopic Mass | 463.97051 |
| SMILES | O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9HF17O2/c10-2(11,1(27)28)3(12,13)4(14,15)5(16,17)6(18,19)7(20,21)8(22,23)9(24,25)26/h(H,27,28) |
| InChIKey | UZUFPBIDKMEQEQ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | persistent organic pollutant Any environmental contaminant that is resistant to environmental degradation through photolytic, biological or chemical processes. Such substances can have significant impact on health and the environment, as they persist in the environment, bioaccumulate in animal tissue and so biomagnify in food chains. surfactant A substance which lowers the surface tension of the medium in which it is dissolved, and/or the interfacial tension with other phases, and, accordingly, is positively adsorbed at the liquid/vapour and/or at other interfaces. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| perfluorononanoic acid (CHEBI:38397) has functional parent nonanoic acid (CHEBI:29019) |
| perfluorononanoic acid (CHEBI:38397) has role persistent organic pollutant (CHEBI:77853) |
| perfluorononanoic acid (CHEBI:38397) has role surfactant (CHEBI:35195) |
| perfluorononanoic acid (CHEBI:38397) has role xenobiotic (CHEBI:35703) |
| perfluorononanoic acid (CHEBI:38397) is a fluoroalkanoic acid (CHEBI:35551) |
| IUPAC Name |
|---|
| heptadecafluorononanoic acid |
| Synonyms | Source |
|---|---|
| perfluoro-n-nonanoic acid | ChemIDplus |
| 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluorononanoic acid | NIST Chemistry WebBook |
| perfluorononanoic acid | NIST Chemistry WebBook |
| perfluorononan-1-oic acid | ChemIDplus |
| PFNA | ChEBI |
| Heptadecafluornonansäure | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Perfluorononanoic_acid | Wikipedia |
| Citations |
|---|