EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H30O2 |
| Net Charge | 0 |
| Average Mass | 278.436 |
| Monoisotopic Mass | 278.22458 |
| SMILES | CCCC/C=C/C=C/C=C/CCCCCCCC(=O)O |
| InChI | InChI=1S/C18H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h5-10H,2-4,11-17H2,1H3,(H,19,20)/b6-5+,8-7+,10-9+ |
| InChIKey | CUXYLFPMQMFGPL-SUTYWZMXSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| all-trans-octadeca-9,11,13-trienoic acid (CHEBI:38384) is a 9,11,13-octadecatrienoic acid (CHEBI:38382) |
| IUPAC Name |
|---|
| (9E,11E,13E)-octadeca-9,11,13-trienoic acid |
| Synonyms | Source |
|---|---|
| 9t,11t,13t-CLN | ChEBI |
| 9t,11t,13t-CLnA | ChEBI |
| 9t,11t,13t-conjugated linolenic acid | ChEBI |
| 9t,11t,13t-linolenic acid | ChEBI |
| (9E,11E,13E)-9,11,13-octadecatrienoic acid | ChemIDplus |
| 9trans,11trans,13trans-octadecatrienoic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMFA01030148 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1726552 | Reaxys |
| CAS:544-73-0 | ChemIDplus |
| Citations |
|---|