EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H32O2 |
| Net Charge | 0 |
| Average Mass | 280.452 |
| Monoisotopic Mass | 280.24023 |
| SMILES | CCCCCCCCCCCC#CCCCCC(=O)O |
| InChI | InChI=1S/C18H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h2-11,14-17H2,1H3,(H,19,20) |
| InChIKey | GVZXZHWIIXHZOB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tariric acid (CHEBI:38362) is a octadecynoic acid (CHEBI:36034) |
| IUPAC Name |
|---|
| octadec-6-ynoic acid |
| Synonyms | Source |
|---|---|
| 6-octadecynoic acid | NIST Chemistry WebBook |
| 6-ODA | ChEBI |
| 6-ODYA | ChEBI |
| Heptadecin-(5)-carbonsäure | ChEBI |
| Octadec-6-insäure | ChEBI |
| Taririnsäure | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMFA01030453 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1726530 | Reaxys |
| CAS:544-74-1 | NIST Chemistry WebBook |
| Citations |
|---|