EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H8O2 |
| Net Charge | 0 |
| Average Mass | 112.128 |
| Monoisotopic Mass | 112.05243 |
| SMILES | C/C=C\C=C/C(=O)O |
| InChI | InChI=1S/C6H8O2/c1-2-3-4-5-6(7)8/h2-5H,1H3,(H,7,8)/b3-2-,5-4- |
| InChIKey | WSWCOQWTEOXDQX-LDIADDGTSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2Z,4Z)-hexa-2,4-dienoic acid (CHEBI:38359) is a sorbic acid (CHEBI:35962) |
| IUPAC Name |
|---|
| (2Z,4Z)-hexa-2,4-dienoic acid |
| Synonyms | Source |
|---|---|
| (2Z,4Z)-2,4-hexadienoic acid | ChEBI |
| cis,cis-sorbic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1720451 | Beilstein |
| Citations |
|---|