EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H19N2O |
| Net Charge | +1 |
| Average Mass | 195.286 |
| Monoisotopic Mass | 195.14919 |
| SMILES | C[N+](C)(C)CC#CCN1CCCC1=O |
| InChI | InChI=1S/C11H19N2O/c1-13(2,3)10-5-4-8-12-9-6-7-11(12)14/h6-10H2,1-3H3/q+1 |
| InChIKey | CANZROMYQDHYHR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | muscarinic agonist Any drug that binds to and activates a muscarinic cholinergic receptor. |
| Application: | muscarinic agonist Any drug that binds to and activates a muscarinic cholinergic receptor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oxotremorine M (CHEBI:38322) has role muscarinic agonist (CHEBI:38325) |
| oxotremorine M (CHEBI:38322) is a quaternary ammonium ion (CHEBI:35267) |
| IUPAC Name |
|---|
| N,N,N-trimethyl-4-(2-oxopyrrolidin-1-yl)but-2-yn-1-aminium |
| Synonym | Source |
|---|---|
| oxotremorine-M | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1532398 | Beilstein |
| CAS:63939-65-1 | ChemIDplus |