EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | H4B2O4 |
| Net Charge | 0 |
| Average Mass | 89.652 |
| Monoisotopic Mass | 90.02957 |
| SMILES | [H]OB(O[H])B(O[H])O[H] |
| InChI | InChI=1S/B2H4O4/c3-1(4)2(5)6/h3-6H |
| InChIKey | SKOWZLGOFVSKLB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | inorganic acid A Brønsted acid derived from one or more inorganic compounds. Inorganic acids (also known as mineral acids) form hydrons and conjugate base ions when dissolved in water. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hypodiboric acid (CHEBI:38289) has parent hydride diborane(4) (CHEBI:38288) |
| hypodiboric acid (CHEBI:38289) has role inorganic acid (CHEBI:138103) |
| hypodiboric acid (CHEBI:38289) is a boron oxoacid (CHEBI:33145) |
| IUPAC Names |
|---|
| hypodiboric acid |
| diborane(4)tetrol |
| Synonyms | Source |
|---|---|
| (HO)2B‒B(OH)2 | IUPAC |
| tetrahydroxydiborane | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Gmelin:164297 | Gmelin |
| CAS:13675-18-8 | NIST Chemistry WebBook |