EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H23N5O6 |
| Net Charge | 0 |
| Average Mass | 381.389 |
| Monoisotopic Mass | 381.16483 |
| SMILES | C/C(=C\CNc1ncnc2ncnc12)CO[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C16H23N5O6/c1-8(2-3-17-14-10-15(19-6-18-10)21-7-20-14)5-26-16-13(25)12(24)11(23)9(4-22)27-16/h2,6-7,9,11-13,16,22-25H,3-5H2,1H3,(H2,17,18,19,20,21)/b8-2+/t9-,11-,12+,13-,16-/m1/s1 |
| InChIKey | UUPDCCPAOMDMPT-HNVSNYHQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cocos nucifera (ncbitaxon:13894) | - | PubMed (15453426) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. cytokinin A phytohormone that promote cell division, or cytokinesis, in plant roots and shoots. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| O-β-D-glucosyl-trans-zeatin (CHEBI:38266) has role plant metabolite (CHEBI:76924) |
| O-β-D-glucosyl-trans-zeatin (CHEBI:38266) is a O-β-D-glucosylzeatin (CHEBI:38646) |
| IUPAC Name |
|---|
| (2E)-2-methyl-4-(9H-purin-6-ylamino)but-2-en-1-yl β-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| O-beta-D-Glucosyl-trans-zeatin | KEGG COMPOUND |
| O-beta-D-Glucosylzeatin | KEGG COMPOUND |
| trans-Zeatin-O-glucoside | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| O-β-D-glucosyl-trans-zeatin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C03423 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1231100 | Reaxys |
| Citations |
|---|