EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H13NO2 |
| Net Charge | 0 |
| Average Mass | 131.175 |
| Monoisotopic Mass | 131.09463 |
| SMILES | CCC(C)C(N)C(=O)O |
| InChI | InChI=1S/C6H13NO2/c1-3-4(2)5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9) |
| InChIKey | AGPKZVBTJJNPAG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-amino-3-methylpentanoic acid (CHEBI:38264) is a branched-chain amino acid (CHEBI:22918) |
| 2-amino-3-methylpentanoic acid (CHEBI:38264) is a α-amino acid (CHEBI:33704) |
| Incoming Relation(s) |
| alloisoleucine (CHEBI:22359) is a 2-amino-3-methylpentanoic acid (CHEBI:38264) |
| isoleucine (CHEBI:24898) is a 2-amino-3-methylpentanoic acid (CHEBI:38264) |
| IUPAC Name |
|---|
| 2-amino-3-methylpentanoic acid |
| Citations |
|---|