EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H9NO3 |
| Net Charge | 0 |
| Average Mass | 119.120 |
| Monoisotopic Mass | 119.05824 |
| SMILES | CC(O)C(N)C(=O)O |
| InChI | InChI=1S/C4H9NO3/c1-2(6)3(5)4(7)8/h2-3,6H,5H2,1H3,(H,7,8) |
| InChIKey | AYFVYJQAPQTCCC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-amino-3-hydroxybutanoic acid (CHEBI:38263) has role plant metabolite (CHEBI:76924) |
| 2-amino-3-hydroxybutanoic acid (CHEBI:38263) is a α-amino acid (CHEBI:33704) |
| Incoming Relation(s) |
| allothreonine (CHEBI:38262) is a 2-amino-3-hydroxybutanoic acid (CHEBI:38263) |
| threonine (CHEBI:26986) is a 2-amino-3-hydroxybutanoic acid (CHEBI:38263) |
| IUPAC Name |
|---|
| 2-amino-3-hydroxybutanoic acid |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1098902 | Beilstein |