EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H12O4 |
| Net Charge | 0 |
| Average Mass | 208.213 |
| Monoisotopic Mass | 208.07356 |
| SMILES | COc1cc(C(=O)O)cc(C)c1C(C)=O |
| InChI | InChI=1S/C11H12O4/c1-6-4-8(11(13)14)5-9(15-3)10(6)7(2)12/h4-5H,1-3H3,(H,13,14) |
| InChIKey | GWSISRLRTQOQNE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| macrophomic acid (CHEBI:38227) has functional parent benzoic acid (CHEBI:30746) |
| macrophomic acid (CHEBI:38227) is a methoxybenzoic acid (CHEBI:25238) |
| macrophomic acid (CHEBI:38227) is conjugate acid of macrophomate (CHEBI:38228) |
| Incoming Relation(s) |
| macrophomate (CHEBI:38228) is conjugate base of macrophomic acid (CHEBI:38227) |
| IUPAC Name |
|---|
| 4-acetyl-3-methoxy-5-methylbenzoic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5743941 | Reaxys |