EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H59NO14 |
| Net Charge | 0 |
| Average Mass | 705.839 |
| Monoisotopic Mass | 705.39356 |
| SMILES | CCCC[C@@H](C)[C@@H](OC(=O)C[C@@H](CC(=O)O)C(=O)O)[C@H](C[C@@H](C)CCCCCC[C@@H](O)C[C@H](O)[C@H](C)N)OC(=O)C[C@@H](CC(=O)O)C(=O)O |
| InChI | InChI=1S/C34H59NO14/c1-5-6-12-21(3)32(49-31(43)18-24(34(46)47)16-29(40)41)27(48-30(42)17-23(33(44)45)15-28(38)39)14-20(2)11-9-7-8-10-13-25(36)19-26(37)22(4)35/h20-27,32,36-37H,5-19,35H2,1-4H3,(H,38,39)(H,40,41)(H,44,45)(H,46,47)/t20-,21+,22-,23+,24+,25+,26-,27-,32+/m0/s1 |
| InChIKey | UXDPXZQHTDAXOZ-STOIETHLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus niger (ncbitaxon:5061) | - | PubMed (20014861) | From Aspergillus niger on grapes and raisins. |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . mycotoxin Poisonous substance produced by fungi. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fumonisin B2 (CHEBI:38225) has role Aspergillus metabolite (CHEBI:76956) |
| fumonisin B2 (CHEBI:38225) has role carcinogenic agent (CHEBI:50903) |
| fumonisin B2 (CHEBI:38225) is a diester (CHEBI:51307) |
| fumonisin B2 (CHEBI:38225) is a diol (CHEBI:23824) |
| fumonisin B2 (CHEBI:38225) is a fumonisin (CHEBI:38224) |
| fumonisin B2 (CHEBI:38225) is a primary amino compound (CHEBI:50994) |
| IUPAC Name |
|---|
| (2R,2'R)-2,2'-{[(5R,6R,7S,9S,16R,18S,19S)-19-amino-16,18-dihydroxy-5,9-dimethylicosane-6,7-diyl]bis[oxy(2-oxoethane-2,1-diyl)]}dibutanedioic acid |
| Synonyms | Source |
|---|---|
| Fumonisin B2 | ChemIDplus |
| FB2 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMSP01080023 | LIPID MAPS |
| C19242 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7327126 | Reaxys |
| CAS:116355-84-1 | ChemIDplus |
| CAS:116355-84-1 | KEGG COMPOUND |