EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H11ClN2O |
| Net Charge | 0 |
| Average Mass | 198.653 |
| Monoisotopic Mass | 198.05599 |
| SMILES | CN(C)C(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C9H11ClN2O/c1-12(2)9(13)11-8-5-3-7(10)4-6-8/h3-6H,1-2H3,(H,11,13) |
| InChIKey | BMLIZLVNXIYGCK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Application: | herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| monuron (CHEBI:38214) has role environmental contaminant (CHEBI:78298) |
| monuron (CHEBI:38214) has role herbicide (CHEBI:24527) |
| monuron (CHEBI:38214) has role xenobiotic (CHEBI:35703) |
| monuron (CHEBI:38214) is a 3-(3,4-substituted-phenyl)-1,1-dimethylurea (CHEBI:157693) |
| monuron (CHEBI:38214) is a monochlorobenzenes (CHEBI:83403) |
| IUPAC Name |
|---|
| 3-(4-chlorophenyl)-1,1-dimethylurea |
| Synonyms | Source |
|---|---|
| 1,1-Dimethyl-3-(p-chlorophenyl)urea | ChemIDplus |
| 3-(p-Chlorophenyl)-1,1-dimethylurea | ChemIDplus |
| CMU | NIST Chemistry WebBook |
| N-(4-chlorophenyl)-N',N'-dimethylurea | IUPAC |
| N'-(4-chlorophenyl)-N,N-dimethylurea | NIST Chemistry WebBook |
| N,N-Dimethyl-N'-(4-chlorophenyl)urea | ChemIDplus |
| UniProt Name | Source |
|---|---|
| monuron | UniProt |