EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H30MgN4O5 |
| Net Charge | 0 |
| Average Mass | 610.953 |
| Monoisotopic Mass | 610.20666 |
| SMILES | C=Cc1c(C)c2[n]3c1/C=C1\N=C(/C=c4/c(C)c5c([n]4[Mg]3)=C(C3=N/C(=C\2)C(C)=C3/C=C/C(=O)O)C(C(=O)OC)C5=O)C(CC)=C1C |
| InChI | InChI=1S/C35H32N4O5.Mg/c1-8-19-15(3)22-12-24-17(5)21(10-11-28(40)41)32(38-24)30-31(35(43)44-7)34(42)29-18(6)25(39-33(29)30)14-27-20(9-2)16(4)23(37-27)13-26(19)36-22;/h8,10-14,31H,1,9H2,2-7H3,(H3,36,37,38,39,40,41,42);/q;+2/p-2/b11-10+,22-12-,23-13-,24-12-,25-14-,26-13-,27-14-,32-30-; |
| InChIKey | DGNIJJSSARBJSH-QRKQXEOSSA-L |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chlorophyll c1 (CHEBI:38202) is a chlorophyll (CHEBI:28966) |
| chlorophyll c1 (CHEBI:38202) is a dicarboxylic acid monoester (CHEBI:36244) |
| chlorophyll c1 (CHEBI:38202) is a methyl ester (CHEBI:25248) |
| Synonym | Source |
|---|---|
| chlorophyll c1 | JCBN |
| Registry Numbers | Sources |
|---|---|
| Beilstein:6996880 | Beilstein |
| Beilstein:5801077 | Beilstein |