EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C54H70MgN4O6 |
| Net Charge | 0 |
| Average Mass | 895.481 |
| Monoisotopic Mass | 894.51458 |
| SMILES | [H]C(=O)c1c(C)c2[n]3c1/C=C1\N=C(/C=c4/c(C)c5c([n]4[Mg]3)=C(C3=N/C(=C\2)[C@@H](C)[C@@H]3CCC(=O)OC/C=C(\C)CCC[C@H](C)CCC[C@H](C)CCCC(C)C)[C@@H](C(=O)OC)C5=O)C(CC)=C1C |
| InChI | InChI=1S/C54H71N4O6.Mg/c1-12-38-34(7)42-27-46-40(29-59)36(9)41(56-46)26-43-35(8)39(51(57-43)49-50(54(62)63-11)53(61)48-37(10)44(58-52(48)49)28-45(38)55-42)22-23-47(60)64-25-24-33(6)21-15-20-32(5)19-14-18-31(4)17-13-16-30(2)3;/h24,26-32,35,39,50H,12-23,25H2,1-11H3,(H-,55,56,57,58,59,61);/q-1;+2/p-1/b33-24+;/t31-,32-,35+,39+,50-;/m1./s1 |
| InChIKey | QXWRYZIMSXOOPY-SKHCYZARSA-M |
| Roles Classification |
|---|
| Biological Role: | cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chlorophyll d (CHEBI:38199) is a chlorophyll (CHEBI:28966) |
| chlorophyll d (CHEBI:38199) is a methyl ester (CHEBI:25248) |
| Synonym | Source |
|---|---|
| chlorophyll d | JCBN |
| Registry Numbers | Sources |
|---|---|
| Beilstein:9543799 | Beilstein |
| CAS:519-63-1 | ChemIDplus |