EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H15NO6 |
| Net Charge | 0 |
| Average Mass | 221.209 |
| Monoisotopic Mass | 221.08994 |
| SMILES | O=C(O)[C@H](CCO)NCC[C@H](O)C(=O)O |
| InChI | InChI=1S/C8H15NO6/c10-4-2-5(7(12)13)9-3-1-6(11)8(14)15/h5-6,9-11H,1-4H2,(H,12,13)(H,14,15)/t5-,6-/m0/s1 |
| InChIKey | YVTYLIZWVFUUMH-WDSKDSINSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| avenic acid B (CHEBI:38156) is a dicarboxylic acid (CHEBI:35692) |
| Synonym | Source |
|---|---|
| N-[(3S)-3-carboxy-3-hydroxypropyl]-L-homoserine | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:5016172 | Beilstein |