EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H10O2 |
| Net Charge | 0 |
| Average Mass | 162.188 |
| Monoisotopic Mass | 162.06808 |
| SMILES | O[C@@H]1C=Cc2ccccc2[C@@H]1O |
| InChI | InChI=1S/C10H10O2/c11-9-6-5-7-3-1-2-4-8(7)10(9)12/h1-6,9-12H/t9-,10+/m1/s1 |
| InChIKey | QPUHWUSUBHNZCG-ZJUUUORDSA-N |
| Roles Classification |
|---|
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). bacterial xenobiotic metabolite Any bacterial metabolite produced by metabolism of a xenobiotic compound in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (1S,2R)-1,2-dihydronaphthalene-1,2-diol (CHEBI:38139) is a cis-1,2-dihydronaphthalene-1,2-diol (CHEBI:15561) |
| (1S,2R)-1,2-dihydronaphthalene-1,2-diol (CHEBI:38139) is enantiomer of (1R,2S)-1,2-dihydronaphthalene-1,2-diol (CHEBI:44343) |
| Incoming Relation(s) |
| (1R,2S)-1,2-dihydronaphthalene-1,2-diol (CHEBI:44343) is enantiomer of (1S,2R)-1,2-dihydronaphthalene-1,2-diol (CHEBI:38139) |
| IUPAC Name |
|---|
| (1S,2R)-1,2-dihydronaphthalene-1,2-diol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5377369 | Reaxys |