EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H23N5O3 |
| Net Charge | 0 |
| Average Mass | 285.348 |
| Monoisotopic Mass | 285.18009 |
| SMILES | COCCCNc1nc(NCCCOC)nc(OC)n1 |
| InChI | InChI=1S/C12H23N5O3/c1-18-8-4-6-13-10-15-11(14-7-5-9-19-2)17-12(16-10)20-3/h4-9H2,1-3H3,(H2,13,14,15,16,17) |
| InChIKey | FWJLFUVWQAXWLE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methometon (CHEBI:38072) has functional parent 6-methoxy-1,3,5-triazine-2,4-diamine (CHEBI:38930) |
| methometon (CHEBI:38072) has role herbicide (CHEBI:24527) |
| methometon (CHEBI:38072) is a diamino-1,3,5-triazine (CHEBI:38170) |
| methometon (CHEBI:38072) is a methoxy-1,3,5-triazine (CHEBI:38177) |
| IUPAC Name |
|---|
| 6-methoxy-N,N'-bis(3-methoxypropyl)-1,3,5-triazine-2,4-diamine |
| Registry Numbers | Sources |
|---|---|
| Beilstein:619769 | Beilstein |
| CAS:1771-07-9 | ChemIDplus |