EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H13ClN6 |
| Net Charge | 0 |
| Average Mass | 240.698 |
| Monoisotopic Mass | 240.08902 |
| SMILES | CCNc1nc(Cl)nc(NC(C)(C)C#N)n1 |
| InChI | InChI=1S/C9H13ClN6/c1-4-12-7-13-6(10)14-8(15-7)16-9(2,3)5-11/h4H2,1-3H3,(H2,12,13,14,15,16) |
| InChIKey | MZZBPDKVEFVLFF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Application: | herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cyanazine (CHEBI:38069) has role environmental contaminant (CHEBI:78298) |
| cyanazine (CHEBI:38069) has role herbicide (CHEBI:24527) |
| cyanazine (CHEBI:38069) has role xenobiotic (CHEBI:35703) |
| cyanazine (CHEBI:38069) is a 1,3,5-triazinylamino nitrile (CHEBI:38176) |
| cyanazine (CHEBI:38069) is a chloro-1,3,5-triazine (CHEBI:38168) |
| Incoming Relation(s) |
| 2-{[4-chloro-6-(ethylamino)-1,3,5-triazin-2-yl]amino}-2-methylbutanenitrile (CHEBI:30265) has functional parent cyanazine (CHEBI:38069) |
| IUPAC Name |
|---|
| 2-{[4-chloro-6-(ethylamino)-1,3,5-triazin-2-yl]amino}-2-methylpropanenitrile |
| Synonyms | Source |
|---|---|
| 2-([4-chloro-6-(ethylamino)-1,3,5-triazin-2-yl]amino)-2-methylpropanenitrile | NIST Chemistry WebBook |
| 2-[[4-chloro-6-(ethylamino)-s-triazin-2-yl]amino]-2-methylpropionitrile | NIST Chemistry WebBook |
| 2-Chloro-4-(1-cyano-1-methylethylamino)-6-ethylamine-1,3,5-triazine | ChemIDplus |
| 2-chloro-4-(1-cyano-1-methylethylamino)-6-ethylamino-1,3,5-triazine | ChEBI |
| Bladex | NIST Chemistry WebBook |
| Cyanazine | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:615509 | Reaxys |
| Beilstein:615509 | Beilstein |
| CAS:21725-46-2 | KEGG COMPOUND |
| CAS:21725-46-2 | ChemIDplus |
| CAS:21725-46-2 | NIST Chemistry WebBook |
| Citations |
|---|