EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C2H5NO3 |
| Net Charge | 0 |
| Average Mass | 91.066 |
| Monoisotopic Mass | 91.02694 |
| SMILES | NC(O)C(=O)O |
| InChI | InChI=1S/C2H5NO3/c3-1(4)2(5)6/h1,4H,3H2,(H,5,6) |
| InChIKey | ZHWLPDIRXJCEJY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| α-hydroxyglycine (CHEBI:38048) is a glycine derivative (CHEBI:24373) |
| α-hydroxyglycine (CHEBI:38048) is a hemiaminal (CHEBI:73080) |
| α-hydroxyglycine (CHEBI:38048) is a hydroxy-amino acid (CHEBI:24662) |
| Incoming Relation(s) |
| (2S)-α-hydroxyglycine (CHEBI:142739) is a α-hydroxyglycine (CHEBI:38048) |
| IUPAC Name |
|---|
| amino(hydroxy)acetic acid |
| Synonyms | Source |
|---|---|
| aminohydroxyacetic acid | ChemIDplus |
| 2-hydroxyglycine | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1811706 | Reaxys |
| CAS:4746-62-7 | ChemIDplus |
| Citations |
|---|