EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H14O6 |
| Net Charge | 0 |
| Average Mass | 182.172 |
| Monoisotopic Mass | 182.07904 |
| SMILES | OC[C@H](O)[C@H](O)[C@@H](O)[C@@H](O)CO |
| WURCS | WURCS=2.0/1,1,0/[h2211h]/1/ |
| InChI | InChI=1S/C6H14O6/c7-1-3(9)5(11)6(12)4(10)2-8/h3-12H,1-2H2/t3-,4-,5-,6-/m0/s1 |
| InChIKey | FBPFZTCFMRRESA-BXKVDMCESA-N |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-mannitol (CHEBI:38030) is a mannitol (CHEBI:29864) |
| Incoming Relation(s) |
| L-mannitol 1,6-bis(methanesulfonate) (CHEBI:18954) has functional parent L-mannitol (CHEBI:38030) |
| IUPAC Name |
|---|
| L-mannitol |
| Citations |
|---|