EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H20N4O2 |
| Net Charge | 0 |
| Average Mass | 300.362 |
| Monoisotopic Mass | 300.15863 |
| SMILES | CCCC1C(=O)N2C(N(C)C)=Nc3ccc(C)cc3N2C1=O |
| InChI | InChI=1S/C16H20N4O2/c1-5-6-11-14(21)19-13-9-10(2)7-8-12(13)17-16(18(3)4)20(19)15(11)22/h7-9,11H,5-6H2,1-4H3 |
| InChIKey | MPHPHYZQRGLTBO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. uricosuric drug A gout suppressant that acts directly on the renal tubule to increase the excretion of uric acid, thus reducing its concentrations in plasma. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| apazone (CHEBI:38010) has parent hydride 1,2,4-benzotriazine (CHEBI:38011) |
| apazone (CHEBI:38010) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| apazone (CHEBI:38010) has role uricosuric drug (CHEBI:35841) |
| apazone (CHEBI:38010) is a benzotriazines (CHEBI:51361) |
| IUPAC Name |
|---|
| 5-(dimethylamino)-9-methyl-2-propyl-1H-pyrazolo[1,2-a][1,2,4]benzotriazine-1,3(2H)-dione |
| INNs | Source |
|---|---|
| azapropazona | ChemIDplus |
| azapropazonum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 1,2-Dihydro-3-dimethylamino-7-methyl-1,2-(propylmalonyl)-1,2,4-benzotriazine | ChemIDplus |
| 3-Dimethylamino-7-methyl-1,2-(n-propylmalonyl)-1,2-dihydro-1,2,4-benzotriazine | ChemIDplus |
| 5-(Dimethylamino)-9-methyl-2-propyl-1H-pyrazolo(1,2-a)(1,2,4)benzotriazine-1,3(2H)-dione | ChemIDplus |
| Azapropazon | ChemIDplus |
| Azapropazone | ChemIDplus |
| MI-85 | ChEMBL |
| Brand Names | Source |
|---|---|
| Rheumox | ChEMBL |
| Rheumox 600 | ChEMBL |
| Citations |
|---|