EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H6OS2 |
| Net Charge | 0 |
| Average Mass | 170.258 |
| Monoisotopic Mass | 169.98601 |
| SMILES | Oc1ccccc1C(=S)S |
| InChI | InChI=1S/C7H6OS2/c8-6-4-2-1-3-5(6)7(9)10/h1-4,8H,(H,9,10) |
| InChIKey | AJQLEJAVGARHGQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dithiosalicylic acid (CHEBI:37999) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| dithiosalicylic acid (CHEBI:37999) is a dithiocarboxylic acid (CHEBI:35736) |
| IUPAC Name |
|---|
| 2-hydroxybenzenecarbodithioic acid |
| Synonym | Source |
|---|---|
| 2-Hydroxydithiobenzoic acid | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2828634 | Beilstein |
| CAS:527-89-9 | ChemIDplus |