EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C43H50N4O14S2 |
| Net Charge | 0 |
| Average Mass | 911.021 |
| Monoisotopic Mass | 910.27649 |
| SMILES | [H]C(=CC([H])=C1N(CCCCCC(=O)ON2C(=O)CCC2=O)c2ccc(S(=O)(=O)O)cc2C1(C)C)C1=[N+](CCCCCC(=O)ON2C(=O)CCC2=O)c2ccc(S(=O)(=O)[O-])cc2C1(C)C |
| InChI | InChI=1S/C43H50N4O14S2/c1-42(2)30-26-28(62(54,55)56)16-18-32(30)44(24-9-5-7-14-40(52)60-46-36(48)20-21-37(46)49)34(42)12-11-13-35-43(3,4)31-27-29(63(57,58)59)17-19-33(31)45(35)25-10-6-8-15-41(53)61-47-38(50)22-23-39(47)51/h11-13,16-19,26-27H,5-10,14-15,20-25H2,1-4H3,(H-,54,55,56,57,58,59) |
| InChIKey | OHOQEZWSNFNUSY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cy3-bifunctional dye zwitterion (CHEBI:37990) is a Cy3 dye (CHEBI:37987) |
| Cy3-bifunctional dye zwitterion (CHEBI:37990) is a iminium betaine (CHEBI:35285) |
| Cy3-bifunctional dye zwitterion (CHEBI:37990) is conjugate acid of Cy3-bifunctional dye(1−) (CHEBI:38046) |
| Incoming Relation(s) |
| Cy3-bifunctional dye(1−) (CHEBI:38046) is conjugate base of Cy3-bifunctional dye zwitterion (CHEBI:37990) |
| IUPAC Name |
|---|
| 1-[6-(2,5-dioxopyrrolidin-1-yloxy)-6-oxohexyl]-2-(3-{1-[6-(2,5-dioxopyrrolidin-1-yloxy)-6-oxohexyl]-3,3-dimethyl-5-sulfo-1,3-dihydro-2H-indol-2-ylidene}prop-1-en-1-yl)-3,3-dimethyl-3H-indolium-5-sulfonate |
| Synonyms | Source |
|---|---|
| Cy 3 | ChemIDplus |
| Cy3 dye | ChemIDplus |
| cyanine dye 3 | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:9983652 | Beilstein |
| CAS:146397-20-8 | ChemIDplus |