EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H37N5O8 |
| Net Charge | 0 |
| Average Mass | 451.521 |
| Monoisotopic Mass | 451.26421 |
| SMILES | NC[C@@H]1CC[C@@H](N)[C@@H](O[C@H]2[C@H](O)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H](N)C[C@@H]2N)O1 |
| InChI | InChI=1S/C18H37N5O8/c19-4-6-1-2-7(20)17(28-6)30-15-8(21)3-9(22)16(14(15)27)31-18-13(26)11(23)12(25)10(5-24)29-18/h6-18,24-27H,1-5,19-23H2/t6-,7+,8-,9+,10+,11-,12+,13+,14-,15+,16-,17+,18+/m0/s1 |
| InChIKey | JJCQSGDBDPYCEO-XVZSLQNASA-N |
| Roles Classification |
|---|
| Biological Roles: | protein synthesis inhibitor A compound, usually an anti-bacterial agent or a toxin, which inhibits the synthesis of a protein. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dibekacin (CHEBI:37945) has functional parent kanamycin B (CHEBI:28098) |
| dibekacin (CHEBI:37945) has role antibacterial agent (CHEBI:33282) |
| dibekacin (CHEBI:37945) has role protein synthesis inhibitor (CHEBI:48001) |
| dibekacin (CHEBI:37945) is a kanamycins (CHEBI:24951) |
| Incoming Relation(s) |
| dibekacin sulfate (CHEBI:31475) has functional parent dibekacin (CHEBI:37945) |
| IUPAC Name |
|---|
| (1R,2S,3S,4R,6S)-4,6-diamino-3-(3-amino-3-deoxy-α-D-glucopyranosyloxy)-2-hydroxycyclohexyl 2,6-diamino-2,3,4,6-tetradeoxy-α-D-erythro-hexopyranoside |
| INN | Source |
|---|---|
| dibekacin | KEGG DRUG |
| Synonyms | Source |
|---|---|
| 3',4'-Dideoxykanamycin B | ChemIDplus |
| DKM | KEGG DRUG |
| O-3-Amino-3-deoxy-alpha-D-glucopyranosyl-(1-4)-O-(2,6-diamino-2,3,4,6-tetradeoxy-alpha-D-erythro-hexopyranosyl-(1-6))-2-deoxy-L-streptamine | ChemIDplus |
| Panamicin | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 855 | DrugCentral |
| CN101278900 | Patent |
| CN101575354 | Patent |
| D07811 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1441606 | Reaxys |
| CAS:34493-98-6 | ChemIDplus |
| Citations |
|---|