EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H9NS |
| Net Charge | 0 |
| Average Mass | 199.278 |
| Monoisotopic Mass | 199.04557 |
| SMILES | C1=CCC2=Nc3ccccc3SC2=C1 |
| InChI | InChI=1S/C12H9NS/c1-3-7-11-9(5-1)13-10-6-2-4-8-12(10)14-11/h1-5,7-8H,6H2 |
| InChIKey | QWXDTDWOYQPERX-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1H-phenothiazine (CHEBI:37934) is a phenothiazine (CHEBI:37932) |
| 1H-phenothiazine (CHEBI:37934) is tautomer of 10H-phenothiazine (CHEBI:37931) |
| 1H-phenothiazine (CHEBI:37934) is tautomer of 3H-phenothiazine (CHEBI:37935) |
| 1H-phenothiazine (CHEBI:37934) is tautomer of 4aH-phenothiazine (CHEBI:37933) |
| Incoming Relation(s) |
| 10H-phenothiazine (CHEBI:37931) is tautomer of 1H-phenothiazine (CHEBI:37934) |
| 3H-phenothiazine (CHEBI:37935) is tautomer of 1H-phenothiazine (CHEBI:37934) |
| 4aH-phenothiazine (CHEBI:37933) is tautomer of 1H-phenothiazine (CHEBI:37934) |
| IUPAC Name |
|---|
| 1H-phenothiazine |