EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H11NO5S |
| Net Charge | 0 |
| Average Mass | 389.388 |
| Monoisotopic Mass | 389.03579 |
| SMILES | O=C1OC2(c3ccc(O)cc3Oc3cc(O)ccc32)c2cc(N=C=S)ccc21 |
| InChI | InChI=1S/C21H11NO5S/c23-12-2-5-15-18(8-12)26-19-9-13(24)3-6-16(19)21(15)17-7-11(22-10-28)1-4-14(17)20(25)27-21/h1-9,23-24H |
| InChIKey | GTQFZXYECNSNNC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. antigen Any substance that stimulates an immune response in the body, such as through antibody production or by presentation to a T-cell receptor after binding to a major histocompability complex (MHC). |
| Applications: | fluorescent probe A role played by a fluorescent molecular entity used to study the microscopic environment by fluorescence spectroscopy. fluorochrome A fluorescent dye used to stain biological specimens. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fluorescein 6-isothiocyanate (CHEBI:37928) is a fluorescein isothiocyanate (CHEBI:37926) |
| IUPAC Name |
|---|
| 3',6'-dihydroxy-6-isothiocyanato-3H-spiro[2-benzofuran-1,9'-xanthen]-3-one |
| Synonyms | Source |
|---|---|
| 6-FITC | ChEBI |
| F6ITC | ChEBI |