EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C38H52N6O7 |
| Net Charge | 0 |
| Average Mass | 704.869 |
| Monoisotopic Mass | 704.38975 |
| SMILES | COC(=O)N[C@H](C(=O)N[C@@H](Cc1ccccc1)[C@@H](O)CN(Cc1ccc(-c2ccccn2)cc1)NC(=O)[C@@H](NC(=O)OC)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C38H52N6O7/c1-37(2,3)31(41-35(48)50-7)33(46)40-29(22-25-14-10-9-11-15-25)30(45)24-44(43-34(47)32(38(4,5)6)42-36(49)51-8)23-26-17-19-27(20-18-26)28-16-12-13-21-39-28/h9-21,29-32,45H,22-24H2,1-8H3,(H,40,46)(H,41,48)(H,42,49)(H,43,47)/t29-,30-,31+,32+/m0/s1 |
| InChIKey | AXRYRYVKAWYZBR-GASGPIRDSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. antiviral agent A substance that destroys or inhibits replication of viruses. anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. HIV protease inhibitor An inhibitor of HIV protease, an enzyme required for production of proteins needed for viral assembly. |
| Applications: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. hypoglycemic agent A drug which lowers the blood glucose level. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| atazanavir (CHEBI:37924) has role anti-HIV agent (CHEBI:64946) |
| atazanavir (CHEBI:37924) has role antineoplastic agent (CHEBI:35610) |
| atazanavir (CHEBI:37924) has role antiviral agent (CHEBI:22587) |
| atazanavir (CHEBI:37924) has role antiviral drug (CHEBI:36044) |
| atazanavir (CHEBI:37924) has role HIV protease inhibitor (CHEBI:35660) |
| atazanavir (CHEBI:37924) has role hypoglycemic agent (CHEBI:35526) |
| atazanavir (CHEBI:37924) is a carbohydrazide (CHEBI:35363) |
| Incoming Relation(s) |
| atazanavir sulfate (CHEBI:31243) has part atazanavir (CHEBI:37924) |
| IUPAC Name |
|---|
| dimethyl (3S,8S,9S,12S)-9-benzyl-3,12-di-tert-butyl-8-hydroxy-4,11-dioxo-6-[4-(2-pyridyl)benzyl]-2,5,6,10,13-pentaazatetradecanedioate |
| INNs | Source |
|---|---|
| atazanavir | ChemIDplus |
| atazanavirum | ChEBI |
| Synonyms | Source |
|---|---|
| ATZ | ChemIDplus |
| CGP-73547 | ChEMBL |
| Brand Names | Source |
|---|---|
| Latazanavir | DrugBank |
| Zrivada | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| Atazanavir | Wikipedia |
| D07471 | KEGG DRUG |
| DB01072 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8101951 | Reaxys |
| CAS:198904-31-3 | ChemIDplus |
| Citations |
|---|