EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C38H52N6O7 |
| Net Charge | 0 |
| Average Mass | 704.869 |
| Monoisotopic Mass | 704.38975 |
| SMILES | COC(=O)N[C@H](C(=O)N[C@@H](Cc1ccccc1)[C@@H](O)CN(Cc1ccc(-c2ccccn2)cc1)NC(=O)[C@@H](NC(=O)OC)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C38H52N6O7/c1-37(2,3)31(41-35(48)50-7)33(46)40-29(22-25-14-10-9-11-15-25)30(45)24-44(43-34(47)32(38(4,5)6)42-36(49)51-8)23-26-17-19-27(20-18-26)28-16-12-13-21-39-28/h9-21,29-32,45H,22-24H2,1-8H3,(H,40,46)(H,41,48)(H,42,49)(H,43,47)/t29-,30-,31+,32+/m0/s1 |
| InChIKey | AXRYRYVKAWYZBR-GASGPIRDSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | HIV protease inhibitor An inhibitor of HIV protease, an enzyme required for production of proteins needed for viral assembly. antiviral drug A substance used in the prophylaxis or therapy of virus diseases. |
| Application: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| atazanavir (CHEBI:37924) has role antiviral drug (CHEBI:36044) |
| atazanavir (CHEBI:37924) has role HIV protease inhibitor (CHEBI:35660) |
| atazanavir (CHEBI:37924) is a carbohydrazide (CHEBI:35363) |
| Incoming Relation(s) |
| atazanavir sulfate (CHEBI:31243) has part atazanavir (CHEBI:37924) |
| IUPAC Name |
|---|
| dimethyl (3S,8S,9S,12S)-9-benzyl-3,12-di-tert-butyl-8-hydroxy-4,11-dioxo-6-[4-(2-pyridyl)benzyl]-2,5,6,10,13-pentaazatetradecanedioate |
| INNs | Source |
|---|---|
| atazanavir | ChemIDplus |
| atazanavirum | ChEBI |
| Synonym | Source |
|---|---|
| ATZ | ChemIDplus |
| Brand Names | Source |
|---|---|
| Latazanavir | DrugBank |
| Zrivada | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| Atazanavir | Wikipedia |
| D07471 | KEGG DRUG |
| DB01072 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8101951 | Reaxys |
| CAS:198904-31-3 | ChemIDplus |
| Citations |
|---|