EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H35N5O6 |
| Net Charge | 0 |
| Average Mass | 405.496 |
| Monoisotopic Mass | 405.25873 |
| SMILES | [H][C@@]1([C@H](C)N)CC[C@@H](N)[C@@H](O[C@@H]2[C@@H](N)[C@H](O)[C@H](OC)[C@@H](N(C)C(=O)CN)[C@H]2O)O1 |
| InChI | InChI=1S/C17H35N5O6/c1-7(19)9-5-4-8(20)17(27-9)28-15-11(21)13(24)16(26-3)12(14(15)25)22(2)10(23)6-18/h7-9,11-17,24-25H,4-6,18-21H2,1-3H3/t7-,8+,9-,11-,12-,13-,14+,15+,16+,17+/m0/s1 |
| InChIKey | BIDUPMYXGFNAEJ-APGVDKLISA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| astromicin (CHEBI:37923) has role antibacterial agent (CHEBI:33282) |
| astromicin (CHEBI:37923) has role metabolite (CHEBI:25212) |
| astromicin (CHEBI:37923) is a amino cyclitol glycoside (CHEBI:22479) |
| astromicin (CHEBI:37923) is a aminoglycoside antibiotic (CHEBI:22507) |
| astromicin (CHEBI:37923) is a diol (CHEBI:23824) |
| astromicin (CHEBI:37923) is a monocarboxylic acid amide (CHEBI:29347) |
| astromicin (CHEBI:37923) is a primary amino compound (CHEBI:50994) |
| Incoming Relation(s) |
| astromycin sulfate (CHEBI:31242) has functional parent astromicin (CHEBI:37923) |
| IUPAC Name |
|---|
| N-[(1S,2R,3R,4S,5S,6R)-4-amino-3-({(2R,3R,6S)-3-amino-6-[(1S)-1-aminoethyl]tetrahydro-2H-pyran-2-yl}oxy)-2,5-dihydroxy-6-methoxycyclohexyl]-N-methylglycinamide |
| INNs | Source |
|---|---|
| astromicin | KEGG DRUG |
| astromicina | ChemIDplus |
| astromicinum | ChemIDplus |
| astromicine | ChemIDplus |
| Synonyms | Source |
|---|---|
| ASTM | KEGG DRUG |
| astromycin | ChEBI |
| antibiotic KW-1070 | ChemIDplus |
| KW 1070 | ChemIDplus |
| XK-70-1 | ChemIDplus |
| fortimicin A | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D07470 | KEGG DRUG |
| C17708 | KEGG COMPOUND |
| Astromicin | Wikipedia |
| 250 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3570275 | Reaxys |
| CAS:55779-06-1 | ChemIDplus |
| CAS:55779-06-1 | KEGG COMPOUND |
| Citations |
|---|