EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H44N6O10 |
| Net Charge | 0 |
| Average Mass | 552.626 |
| Monoisotopic Mass | 552.31189 |
| SMILES | NCC[C@H](O)C(=O)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)CC[C@H]2N)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O |
| InChI | InChI=1S/C22H44N6O10/c23-4-3-12(30)20(34)28-11-5-10(26)18(37-21-9(25)2-1-8(6-24)35-21)17(33)19(11)38-22-16(32)14(27)15(31)13(7-29)36-22/h8-19,21-22,29-33H,1-7,23-27H2,(H,28,34)/t8-,9+,10-,11+,12-,13+,14-,15+,16+,17-,18+,19-,21+,22+/m0/s1 |
| InChIKey | MKKYBZZTJQGVCD-XTCKQBCOSA-N |
| Roles Classification |
|---|
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antibacterial drug A drug used to treat or prevent bacterial infections. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. protein synthesis inhibitor A compound, usually an anti-bacterial agent or a toxin, which inhibits the synthesis of a protein. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| arbekacin (CHEBI:37922) has functional parent kanamycin B (CHEBI:28098) |
| arbekacin (CHEBI:37922) has role antibacterial agent (CHEBI:33282) |
| arbekacin (CHEBI:37922) has role antibacterial drug (CHEBI:36047) |
| arbekacin (CHEBI:37922) has role antimicrobial agent (CHEBI:33281) |
| arbekacin (CHEBI:37922) has role protein synthesis inhibitor (CHEBI:48001) |
| arbekacin (CHEBI:37922) is a aminoglycoside (CHEBI:47779) |
| arbekacin (CHEBI:37922) is a kanamycins (CHEBI:24951) |
| Incoming Relation(s) |
| arbekacin sulfate (CHEBI:31233) has functional parent arbekacin (CHEBI:37922) |
| IUPAC Name |
|---|
| (2S)-4-amino-N-[(1R,2S,3S,4R,5S)-5-amino-2-(3-amino-3-deoxy-α-D-glucopyranosyloxy)-4-(2,6-diamino-2,3,4,6-tetradeoxy-α-D-erythro-hexopyranosyloxy)-3-hydroxycyclohexyl]-2-hydroxybutanamide |
| INN | Source |
|---|---|
| arbekacin | KEGG DRUG |
| Synonym | Source |
|---|---|
| ABK | KEGG DRUG |
| Citations |
|---|