EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H11NO5S |
| Net Charge | 0 |
| Average Mass | 389.388 |
| Monoisotopic Mass | 389.03579 |
| SMILES | O=C1OC2(c3ccc(O)cc3Oc3cc(O)ccc32)c2ccc(N=C=S)cc21 |
| InChI | InChI=1S/C21H11NO5S/c23-12-2-5-16-18(8-12)26-19-9-13(24)3-6-17(19)21(16)15-4-1-11(22-10-28)7-14(15)20(25)27-21/h1-9,23-24H |
| InChIKey | MHMNJMPURVTYEJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | antigen Any substance that stimulates an immune response in the body, such as through antibody production or by presentation to a T-cell receptor after binding to a major histocompability complex (MHC). hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. |
| Applications: | fluorochrome A fluorescent dye used to stain biological specimens. fluorescent probe A role played by a fluorescent molecular entity used to study the microscopic environment by fluorescence spectroscopy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fluorescein 5-isothiocyanate (CHEBI:37918) is a fluorescein isothiocyanate (CHEBI:37926) |
| IUPAC Name |
|---|
| 3',6'-dihydroxy-5-isothiocyanato-3H-spiro[2-benzofuran-1,9'-xanthen]-3-one |
| Synonyms | Source |
|---|---|
| 2-(6-Hydroxy-3-oxo-(3H)-xanthen-9-yl)-5-isothiocyanatobenzoic acid | ChemIDplus |
| 3',6'-dihydroxy-5-isothiocyanatospiro(isobenzofuran-1(3H),9'-(9H)xanthen)-3-one | ChemIDplus |
| 5-FITC | ChEBI |
| 5-isothiocyanatofluorescein | ChEBI |
| F5ITC | ChEBI |
| FITC-I | ChEBI |
| Citations |
|---|