EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H28O |
| Net Charge | 0 |
| Average Mass | 272.432 |
| Monoisotopic Mass | 272.21402 |
| SMILES | [H][C@@]12CC[C@]3([H])[C@]([H])(CC[C@]4(C)C=CC[C@@]34[H])[C@@]1(C)CCC(=O)C2 |
| InChI | InChI=1S/C19H28O/c1-18-9-3-4-16(18)15-6-5-13-12-14(20)7-11-19(13,2)17(15)8-10-18/h3,9,13,15-17H,4-8,10-12H2,1-2H3/t13-,15-,16-,17-,18-,19-/m0/s1 |
| InChIKey | HFVMLYAGWXSTQI-QYXZOKGRSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | pheromone A semiochemical used in olfactory communication between organisms of the same species eliciting a change in sexual or social behaviour. mammalian metabolite Any animal metabolite produced during a metabolic reaction in mammals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5α-androst-16-en-3-one (CHEBI:37894) has parent hydride 5α-androst-16-ene (CHEBI:37927) |
| 5α-androst-16-en-3-one (CHEBI:37894) has role mammalian metabolite (CHEBI:75768) |
| 5α-androst-16-en-3-one (CHEBI:37894) has role pheromone (CHEBI:26013) |
| 5α-androst-16-en-3-one (CHEBI:37894) is a 3-oxo steroid (CHEBI:47788) |
| 5α-androst-16-en-3-one (CHEBI:37894) is a androstanoid (CHEBI:50402) |
| IUPAC Name |
|---|
| 5α-androst-16-en-3-one |
| Synonym | Source |
|---|---|
| androstenone | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMST02020079 | LIPID MAPS |
| HMDB0034406 | HMDB |
| Androstenone | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2379783 | Reaxys |
| CAS:18339-16-7 | ChemIDplus |
| Citations |
|---|