EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H18O |
| Net Charge | 0 |
| Average Mass | 130.231 |
| Monoisotopic Mass | 130.13577 |
| SMILES | CCCCCC[C@@H](C)O |
| InChI | InChI=1S/C8H18O/c1-3-4-5-6-7-8(2)9/h8-9H,3-7H2,1-2H3/t8-/m1/s1 |
| InChIKey | SJWFXCIHNDVPSH-MRVPVSSYSA-N |
| Roles Classification |
|---|
| Biological Roles: | volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2R)-octan-2-ol (CHEBI:37871) is a octan-2-ol (CHEBI:37869) |
| (2R)-octan-2-ol (CHEBI:37871) is enantiomer of (2S)-octan-2-ol (CHEBI:37870) |
| Incoming Relation(s) |
| (2S)-octan-2-ol (CHEBI:37870) is enantiomer of (2R)-octan-2-ol (CHEBI:37871) |
| IUPAC Name |
|---|
| (2R)-octan-2-ol |
| Synonyms | Source |
|---|---|
| (2R)-2-octanol | ChemIDplus |
| l-octan-2-ol | ChemIDplus |
| (R)-(−)-2-octanol | NIST Chemistry WebBook |
| (R)-2-octanol | NIST Chemistry WebBook |
| UniProt Name | Source |
|---|---|
| (2R)-octan-2-ol | UniProt |