EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H8ClN |
| Net Charge | 0 |
| Average Mass | 141.601 |
| Monoisotopic Mass | 141.03453 |
| SMILES | Cc1ccc(N)cc1Cl |
| InChI | InChI=1S/C7H8ClN/c1-5-2-3-6(9)4-7(5)8/h2-4H,9H2,1H3 |
| InChIKey | RQKFYFNZSHWXAW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | avicide A substance used to destroy bird pests (class Aves). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-chloro-p-toluidine (CHEBI:37824) has functional parent p-toluidine (CHEBI:37825) |
| 3-chloro-p-toluidine (CHEBI:37824) has role avicide (CHEBI:33289) |
| 3-chloro-p-toluidine (CHEBI:37824) is a chloroaniline (CHEBI:23130) |
| 3-chloro-p-toluidine (CHEBI:37824) is a monochlorobenzenes (CHEBI:83403) |
| IUPAC Name |
|---|
| 3-chloro-4-methylaniline |
| Synonyms | Source |
|---|---|
| 1-Amino-3-chloro-4-methylbenzene | ChemIDplus |
| 2-Chloro-4-aminotoluene | ChemIDplus |
| 3-Chloro-4-methylbenzenamine | ChemIDplus |
| 3-Chloro-4-methylphenylamine | ChemIDplus |