EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | H3NO3 |
| Net Charge | 0 |
| Average Mass | 65.028 |
| Monoisotopic Mass | 65.01129 |
| SMILES | [H][N+]([O-])(O)O |
| InChI | InChI=1S/H3NO3/c2-1(3)4/h1-3H |
| InChIKey | LUCMUCKPKZWJHC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | inorganic acid A Brønsted acid derived from one or more inorganic compounds. Inorganic acids (also known as mineral acids) form hydrons and conjugate base ions when dissolved in water. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| azonic acid (CHEBI:37769) is a nitrogen oxoacid (CHEBI:33455) |
| Incoming Relation(s) |
| azonoyl group (CHEBI:37768) is substituent group from azonic acid (CHEBI:37769) |
| IUPAC Name |
|---|
| azonic acid |
| Synonyms | Source |
|---|---|
| dihydroxyazane oxide | ChEBI |
| NH(O)(OH)2 | IUPAC |