EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12O6 |
| Net Charge | 0 |
| Average Mass | 180.156 |
| Monoisotopic Mass | 180.06339 |
| SMILES | [H]C(=O)[C@@H](O)[C@@H](O)[C@@H](O)[C@@H](O)CO |
| WURCS | WURCS=2.0/1,1,0/[o1111h]/1/ |
| InChI | InChI=1S/C6H12O6/c7-1-3(9)5(11)6(12)4(10)2-8/h1,3-6,8-12H,2H2/t3-,4+,5-,6+/m1/s1 |
| InChIKey | GZCGUPFRVQAUEE-MOJAZDJTSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aldehydo-L-allose (CHEBI:37746) is a aldehydo-allose (CHEBI:37748) |
| aldehydo-L-allose (CHEBI:37746) is a L-allose (CHEBI:37747) |
| aldehydo-L-allose (CHEBI:37746) is enantiomer of aldehydo-D-allose (CHEBI:40822) |
| Incoming Relation(s) |
| aldehydo-D-allose (CHEBI:40822) is enantiomer of aldehydo-L-allose (CHEBI:37746) |
| IUPAC Names |
|---|
| aldehydo-L-allose |
| aldehydo-L-allo-hexose |
| Synonym | Source |
|---|---|
| (2S,3S,4S,5S)-2,3,4,5,6-pentahydroxyhexanal | IUPAC |
| Manual Xrefs | Databases |
|---|---|
| G14987PW | GlyTouCan |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1724618 | Beilstein |