EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H14O12P2 |
| Net Charge | 0 |
| Average Mass | 340.114 |
| Monoisotopic Mass | 339.99605 |
| SMILES | O=P(O)(O)OC[C@H]1OC(O)(COP(=O)(O)O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H14O12P2/c7-4-3(1-16-19(10,11)12)18-6(9,5(4)8)2-17-20(13,14)15/h3-5,7-9H,1-2H2,(H2,10,11,12)(H2,13,14,15)/t3-,4-,5+,6?/m1/s1 |
| InChIKey | RNBGYGVWRKECFJ-VRPWFDPXSA-N |
| Roles Classification |
|---|
| Biological Role: | fundamental metabolite Any metabolite produced by all living cells. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-fructofuranose 1,6-bisphosphate (CHEBI:37736) has functional parent D-fructofuranose (CHEBI:37721) |
| D-fructofuranose 1,6-bisphosphate (CHEBI:37736) is a D-fructose 1,6-bisphosphate (CHEBI:78682) |
| D-fructofuranose 1,6-bisphosphate (CHEBI:37736) is conjugate acid of D-fructofuranose 1,6-bisphosphate(4−) (CHEBI:49299) |
| Incoming Relation(s) |
| α-D-fructofuranose 1,6-bisphosphate (CHEBI:40595) is a D-fructofuranose 1,6-bisphosphate (CHEBI:37736) |
| β-D-fructofuranose 1,6-bisphosphate (CHEBI:28013) is a D-fructofuranose 1,6-bisphosphate (CHEBI:37736) |
| D-fructofuranose 1,6-bisphosphate(4−) (CHEBI:49299) is conjugate base of D-fructofuranose 1,6-bisphosphate (CHEBI:37736) |
| IUPAC Name |
|---|
| D-fructofuranose 1,6-bis(dihydrogen phosphate) |
| Synonym | Source |
|---|---|
| 1,6-di-O-phosphono-D-fructofuranose | IUPAC |