EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12O6 |
| Net Charge | 0 |
| Average Mass | 180.156 |
| Monoisotopic Mass | 180.06339 |
| SMILES | OC[C@]1(O)OC[C@H](O)[C@H](O)[C@H]1O |
| WURCS | WURCS=2.0/1,1,0/[ha211h-2b_2-6]/1/ |
| InChI | InChI=1S/C6H12O6/c7-2-6(11)5(10)4(9)3(8)1-12-6/h3-5,7-11H,1-2H2/t3-,4-,5+,6-/m0/s1 |
| InChIKey | LKDRXBCSQODPBY-AZGQCCRYSA-N |
| Roles Classification |
|---|
| Biological Role: | fundamental metabolite Any metabolite produced by all living cells. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| β-L-fructopyranose (CHEBI:37729) is a L-fructopyranose (CHEBI:37715) |
| β-L-fructopyranose (CHEBI:37729) is enantiomer of β-D-fructopyranose (CHEBI:41005) |
| Incoming Relation(s) |
| β-D-fructopyranose (CHEBI:41005) is enantiomer of β-L-fructopyranose (CHEBI:37729) |
| IUPAC Name |
|---|
| β-L-fructopyranose |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2206303 | Beilstein |